C11H21N3O2 — CID 103454995
1-(2-propan-2-yl-1,2,4-triazol-3-yl)hexane-2,3-diol (PubChem CID 103454995) has the molecular formula C11H21N3O2 and a molecular weight of 227.31 g/mol. Its IUPAC name is 1-(2-propan-2-yl-1,2,4-triazol-3-yl)hexane-2,3-diol.
| Compound Name | 1-(2-propan-2-yl-1,2,4-triazol-3-yl)hexane-2,3-diol |
|---|---|
| PubChem CID | 103454995 |
| Molecular Formula | C11H21N3O2 |
| Molecular Weight | 227.31 g/mol |
| Exact Mass | 227.16 |
| IUPAC Name | 1-(2-propan-2-yl-1,2,4-triazol-3-yl)hexane-2,3-diol |
| SMILES | CCCC(O)C(O)Cc1ncnn1C(C)C |
| InChI | InChI=1S/C11H21N3O2/c1-4-5-9(15)10(16)6-11-12-7-13-14(11)8(2)3/h7-10,15-16H,4-6H2,1-3H3 |
| InChIKey | SNBXVPOITMKYLU-UHFFFAOYSA-N |
| XLogP | 0.92 |
| TPSA | 71.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.31 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |