C9H19N5S — CID 105214004
[1-methylsulfanyl-3-(2-propan-2-yl-1,2,4-triazol-3-yl)propan-2-yl]hydrazine (PubChem CID 105214004) has the molecular formula C9H19N5S and a molecular weight of 229.35 g/mol. Its IUPAC name is [1-methylsulfanyl-3-(2-propan-2-yl-1,2,4-triazol-3-yl)propan-2-yl]hydrazine.
| Compound Name | [1-methylsulfanyl-3-(2-propan-2-yl-1,2,4-triazol-3-yl)propan-2-yl]hydrazine |
|---|---|
| PubChem CID | 105214004 |
| Molecular Formula | C9H19N5S |
| Molecular Weight | 229.35 g/mol |
| Exact Mass | 229.14 |
| IUPAC Name | [1-methylsulfanyl-3-(2-propan-2-yl-1,2,4-triazol-3-yl)propan-2-yl]hydrazine |
| SMILES | CSCC(Cc1ncnn1C(C)C)NN |
| InChI | InChI=1S/C9H19N5S/c1-7(2)14-9(11-6-12-14)4-8(13-10)5-15-3/h6-8,13H,4-5,10H2,1-3H3 |
| InChIKey | PEUIRYRKCIYPNN-UHFFFAOYSA-N |
| XLogP | 0.60 |
| TPSA | 68.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.35 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|