C14H19ClFN5 — CID 105216212
[1-(2-chloro-4-fluorophenyl)-3-(2-propan-2-yl-1,2,4-triazol-3-yl)propan-2-yl]hydrazine (PubChem CID 105216212) has the molecular formula C14H19ClFN5 and a molecular weight of 311.79 g/mol. Its IUPAC name is [1-(2-chloro-4-fluorophenyl)-3-(2-propan-2-yl-1,2,4-triazol-3-yl)propan-2-yl]hydrazine.
| Compound Name | [1-(2-chloro-4-fluorophenyl)-3-(2-propan-2-yl-1,2,4-triazol-3-yl)propan-2-yl]hydrazine |
|---|---|
| PubChem CID | 105216212 |
| Molecular Formula | C14H19ClFN5 |
| Molecular Weight | 311.79 g/mol |
| Exact Mass | 311.13 |
| IUPAC Name | [1-(2-chloro-4-fluorophenyl)-3-(2-propan-2-yl-1,2,4-triazol-3-yl)propan-2-yl]hydrazine |
| SMILES | CC(C)n1ncnc1CC(Cc1ccc(F)cc1Cl)NN |
| InChI | InChI=1S/C14H19ClFN5/c1-9(2)21-14(18-8-19-21)7-12(20-17)5-10-3-4-11(16)6-13(10)15/h3-4,6,8-9,12,20H,5,7,17H2,1-2H3 |
| InChIKey | HXFPMXKGIDSFTB-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 68.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.79 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|