C15H23N5 — CID 105209011
[1-(3-methylphenyl)-3-(2-propan-2-yl-1,2,4-triazol-3-yl)propan-2-yl]hydrazine (PubChem CID 105209011) has the molecular formula C15H23N5 and a molecular weight of 273.38 g/mol. Its IUPAC name is [1-(3-methylphenyl)-3-(2-propan-2-yl-1,2,4-triazol-3-yl)propan-2-yl]hydrazine.
| Compound Name | [1-(3-methylphenyl)-3-(2-propan-2-yl-1,2,4-triazol-3-yl)propan-2-yl]hydrazine |
|---|---|
| PubChem CID | 105209011 |
| Molecular Formula | C15H23N5 |
| Molecular Weight | 273.38 g/mol |
| Exact Mass | 273.20 |
| IUPAC Name | [1-(3-methylphenyl)-3-(2-propan-2-yl-1,2,4-triazol-3-yl)propan-2-yl]hydrazine |
| SMILES | Cc1cccc(CC(Cc2ncnn2C(C)C)NN)c1 |
| InChI | InChI=1S/C15H23N5/c1-11(2)20-15(17-10-18-20)9-14(19-16)8-13-6-4-5-12(3)7-13/h4-7,10-11,14,19H,8-9,16H2,1-3H3 |
| InChIKey | GJLKNDWOVZTZGZ-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 68.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.38 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|