C10H21N5O2 — CID 105246125
[1,1-dimethoxy-3-(2-propan-2-yl-1,2,4-triazol-3-yl)propan-2-yl]hydrazine (PubChem CID 105246125) has the molecular formula C10H21N5O2 and a molecular weight of 243.31 g/mol. Its IUPAC name is [1,1-dimethoxy-3-(2-propan-2-yl-1,2,4-triazol-3-yl)propan-2-yl]hydrazine.
| Compound Name | [1,1-dimethoxy-3-(2-propan-2-yl-1,2,4-triazol-3-yl)propan-2-yl]hydrazine |
|---|---|
| PubChem CID | 105246125 |
| Molecular Formula | C10H21N5O2 |
| Molecular Weight | 243.31 g/mol |
| Exact Mass | 243.17 |
| IUPAC Name | [1,1-dimethoxy-3-(2-propan-2-yl-1,2,4-triazol-3-yl)propan-2-yl]hydrazine |
| SMILES | COC(OC)C(Cc1ncnn1C(C)C)NN |
| InChI | InChI=1S/C10H21N5O2/c1-7(2)15-9(12-6-13-15)5-8(14-11)10(16-3)17-4/h6-8,10,14H,5,11H2,1-4H3 |
| InChIKey | ZIBNFCYRBCGXER-UHFFFAOYSA-N |
| XLogP | -0.15 |
| TPSA | 87.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.31 |
| LogP ≤ 5 | -0.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|