C10H13ClN4S — CID 106046082
2-(5-chlorothiophen-2-yl)-N-[(2-methyl-1,2,4-triazol-3-yl)methyl]ethanamine (PubChem CID 106046082) has the molecular formula C10H13ClN4S and a molecular weight of 256.76 g/mol. Its IUPAC name is 2-(5-chlorothiophen-2-yl)-N-[(2-methyl-1,2,4-triazol-3-yl)methyl]ethanamine.
| Compound Name | 2-(5-chlorothiophen-2-yl)-N-[(2-methyl-1,2,4-triazol-3-yl)methyl]ethanamine |
|---|---|
| PubChem CID | 106046082 |
| Molecular Formula | C10H13ClN4S |
| Molecular Weight | 256.76 g/mol |
| Exact Mass | 256.05 |
| IUPAC Name | 2-(5-chlorothiophen-2-yl)-N-[(2-methyl-1,2,4-triazol-3-yl)methyl]ethanamine |
| SMILES | Cn1ncnc1CNCCc1ccc(Cl)s1 |
| InChI | InChI=1S/C10H13ClN4S/c1-15-10(13-7-14-15)6-12-5-4-8-2-3-9(11)16-8/h2-3,7,12H,4-6H2,1H3 |
| InChIKey | RYIDEQRAVWOSBY-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 42.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.76 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|