C14H19Cl2N3S — CID 106046742
N-[(4-chloro-1,3-diethylpyrazol-5-yl)methyl]-2-(5-chlorothiophen-2-yl)ethanamine (PubChem CID 106046742) has the molecular formula C14H19Cl2N3S and a molecular weight of 332.30 g/mol. Its IUPAC name is N-[(4-chloro-1,3-diethylpyrazol-5-yl)methyl]-2-(5-chlorothiophen-2-yl)ethanamine.
| Compound Name | N-[(4-chloro-1,3-diethylpyrazol-5-yl)methyl]-2-(5-chlorothiophen-2-yl)ethanamine |
|---|---|
| PubChem CID | 106046742 |
| Molecular Formula | C14H19Cl2N3S |
| Molecular Weight | 332.30 g/mol |
| Exact Mass | 331.07 |
| IUPAC Name | N-[(4-chloro-1,3-diethylpyrazol-5-yl)methyl]-2-(5-chlorothiophen-2-yl)ethanamine |
| SMILES | CCc1nn(CC)c(CNCCc2ccc(Cl)s2)c1Cl |
| InChI | InChI=1S/C14H19Cl2N3S/c1-3-11-14(16)12(19(4-2)18-11)9-17-8-7-10-5-6-13(15)20-10/h5-6,17H,3-4,7-9H2,1-2H3 |
| InChIKey | XMPYKEBTUPRZOP-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 29.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.30 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|