C17H32ClN3 — CID 107815099
N-[(4-chloro-1,3-diethylpyrazol-5-yl)methyl]-7-methyloctan-1-amine (PubChem CID 107815099) has the molecular formula C17H32ClN3 and a molecular weight of 313.92 g/mol. Its IUPAC name is N-[(4-chloro-1,3-diethylpyrazol-5-yl)methyl]-7-methyloctan-1-amine.
| Compound Name | N-[(4-chloro-1,3-diethylpyrazol-5-yl)methyl]-7-methyloctan-1-amine |
|---|---|
| PubChem CID | 107815099 |
| Molecular Formula | C17H32ClN3 |
| Molecular Weight | 313.92 g/mol |
| Exact Mass | 313.23 |
| IUPAC Name | N-[(4-chloro-1,3-diethylpyrazol-5-yl)methyl]-7-methyloctan-1-amine |
| SMILES | CCc1nn(CC)c(CNCCCCCCC(C)C)c1Cl |
| InChI | InChI=1S/C17H32ClN3/c1-5-15-17(18)16(21(6-2)20-15)13-19-12-10-8-7-9-11-14(3)4/h14,19H,5-13H2,1-4H3 |
| InChIKey | NKOCWQMXHJTXRL-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 29.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.92 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|