C13H21Cl2N3 — CID 115455672
1-(4-chloro-1,3-diethylpyrazol-5-yl)-N-[[1-(chloromethyl)cyclopropyl]methyl]methanamine (PubChem CID 115455672) has the molecular formula C13H21Cl2N3 and a molecular weight of 290.24 g/mol. Its IUPAC name is 1-(4-chloro-1,3-diethylpyrazol-5-yl)-N-[[1-(chloromethyl)cyclopropyl]methyl]methanamine.
| Compound Name | 1-(4-chloro-1,3-diethylpyrazol-5-yl)-N-[[1-(chloromethyl)cyclopropyl]methyl]methanamine |
|---|---|
| PubChem CID | 115455672 |
| Molecular Formula | C13H21Cl2N3 |
| Molecular Weight | 290.24 g/mol |
| Exact Mass | 289.11 |
| IUPAC Name | 1-(4-chloro-1,3-diethylpyrazol-5-yl)-N-[[1-(chloromethyl)cyclopropyl]methyl]methanamine |
| SMILES | CCc1nn(CC)c(CNCC2(CCl)CC2)c1Cl |
| InChI | InChI=1S/C13H21Cl2N3/c1-3-10-12(15)11(18(4-2)17-10)7-16-9-13(8-14)5-6-13/h16H,3-9H2,1-2H3 |
| InChIKey | KDSHWXJIANFBCF-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 29.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.24 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|