C15H27Cl2N3 — CID 106117116
N-[(4-chloro-1,3-diethylpyrazol-5-yl)methyl]-2-(2-chloroethyl)pentan-1-amine (PubChem CID 106117116) has the molecular formula C15H27Cl2N3 and a molecular weight of 320.31 g/mol. Its IUPAC name is N-[(4-chloro-1,3-diethylpyrazol-5-yl)methyl]-2-(2-chloroethyl)pentan-1-amine.
| Compound Name | N-[(4-chloro-1,3-diethylpyrazol-5-yl)methyl]-2-(2-chloroethyl)pentan-1-amine |
|---|---|
| PubChem CID | 106117116 |
| Molecular Formula | C15H27Cl2N3 |
| Molecular Weight | 320.31 g/mol |
| Exact Mass | 319.16 |
| IUPAC Name | N-[(4-chloro-1,3-diethylpyrazol-5-yl)methyl]-2-(2-chloroethyl)pentan-1-amine |
| SMILES | CCCC(CCCl)CNCc1c(Cl)c(CC)nn1CC |
| InChI | InChI=1S/C15H27Cl2N3/c1-4-7-12(8-9-16)10-18-11-14-15(17)13(5-2)19-20(14)6-3/h12,18H,4-11H2,1-3H3 |
| InChIKey | FMCGNARUDJYQEV-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 29.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.31 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|