C13H24ClN3O — CID 114147580
5-[(4-chloro-1,3-diethylpyrazol-5-yl)methylamino]pentan-2-ol (PubChem CID 114147580) has the molecular formula C13H24ClN3O and a molecular weight of 273.81 g/mol. Its IUPAC name is 5-[(4-chloro-1,3-diethylpyrazol-5-yl)methylamino]pentan-2-ol.
| Compound Name | 5-[(4-chloro-1,3-diethylpyrazol-5-yl)methylamino]pentan-2-ol |
|---|---|
| PubChem CID | 114147580 |
| Molecular Formula | C13H24ClN3O |
| Molecular Weight | 273.81 g/mol |
| Exact Mass | 273.16 |
| IUPAC Name | 5-[(4-chloro-1,3-diethylpyrazol-5-yl)methylamino]pentan-2-ol |
| SMILES | CCc1nn(CC)c(CNCCCC(C)O)c1Cl |
| InChI | InChI=1S/C13H24ClN3O/c1-4-11-13(14)12(17(5-2)16-11)9-15-8-6-7-10(3)18/h10,15,18H,4-9H2,1-3H3 |
| InChIKey | VPHTWRYAPRDWIN-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 50.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.81 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|