C15H25ClN4O — CID 79377561
4-[(4-chloro-1,3-diethylpyrazol-5-yl)methylamino]-N-cyclopropylbutanamide (PubChem CID 79377561) has the molecular formula C15H25ClN4O and a molecular weight of 312.85 g/mol. Its IUPAC name is 4-[(4-chloro-1,3-diethylpyrazol-5-yl)methylamino]-N-cyclopropylbutanamide.
| Compound Name | 4-[(4-chloro-1,3-diethylpyrazol-5-yl)methylamino]-N-cyclopropylbutanamide |
|---|---|
| PubChem CID | 79377561 |
| Molecular Formula | C15H25ClN4O |
| Molecular Weight | 312.85 g/mol |
| Exact Mass | 312.17 |
| IUPAC Name | 4-[(4-chloro-1,3-diethylpyrazol-5-yl)methylamino]-N-cyclopropylbutanamide |
| SMILES | CCc1nn(CC)c(CNCCCC(=O)NC2CC2)c1Cl |
| InChI | InChI=1S/C15H25ClN4O/c1-3-12-15(16)13(20(4-2)19-12)10-17-9-5-6-14(21)18-11-7-8-11/h11,17H,3-10H2,1-2H3,(H,18,21) |
| InChIKey | CWDSUYDDAQFUCF-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 58.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.85 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|