C12H19BrClN3O2 — CID 103492239
methyl 2-bromo-3-[(4-chloro-1,3-diethylpyrazol-5-yl)methylamino]propanoate (PubChem CID 103492239) has the molecular formula C12H19BrClN3O2 and a molecular weight of 352.66 g/mol. Its IUPAC name is methyl 2-bromo-3-[(4-chloro-1,3-diethylpyrazol-5-yl)methylamino]propanoate.
| Compound Name | methyl 2-bromo-3-[(4-chloro-1,3-diethylpyrazol-5-yl)methylamino]propanoate |
|---|---|
| PubChem CID | 103492239 |
| Molecular Formula | C12H19BrClN3O2 |
| Molecular Weight | 352.66 g/mol |
| Exact Mass | 351.03 |
| IUPAC Name | methyl 2-bromo-3-[(4-chloro-1,3-diethylpyrazol-5-yl)methylamino]propanoate |
| SMILES | CCc1nn(CC)c(CNCC(Br)C(=O)OC)c1Cl |
| InChI | InChI=1S/C12H19BrClN3O2/c1-4-9-11(14)10(17(5-2)16-9)7-15-6-8(13)12(18)19-3/h8,15H,4-7H2,1-3H3 |
| InChIKey | LFUKQDWMRWKHAC-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 56.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.66 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|