C10H17ClN4O2 — CID 106174614
3-[(4-chloro-3-ethyl-1-methylpyrazol-5-yl)methylamino]-2-hydroxypropanamide (PubChem CID 106174614) has the molecular formula C10H17ClN4O2 and a molecular weight of 260.72 g/mol. Its IUPAC name is 3-[(4-chloro-3-ethyl-1-methylpyrazol-5-yl)methylamino]-2-hydroxypropanamide.
| Compound Name | 3-[(4-chloro-3-ethyl-1-methylpyrazol-5-yl)methylamino]-2-hydroxypropanamide |
|---|---|
| PubChem CID | 106174614 |
| Molecular Formula | C10H17ClN4O2 |
| Molecular Weight | 260.72 g/mol |
| Exact Mass | 260.10 |
| IUPAC Name | 3-[(4-chloro-3-ethyl-1-methylpyrazol-5-yl)methylamino]-2-hydroxypropanamide |
| SMILES | CCc1nn(C)c(CNCC(O)C(N)=O)c1Cl |
| InChI | InChI=1S/C10H17ClN4O2/c1-3-6-9(11)7(15(2)14-6)4-13-5-8(16)10(12)17/h8,13,16H,3-5H2,1-2H3,(H2,12,17) |
| InChIKey | WIVVFFKKSMMTPH-UHFFFAOYSA-N |
| XLogP | -0.43 |
| TPSA | 93.17 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.72 |
| LogP ≤ 5 | -0.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |