C11H20ClN3O — CID 82714391
1-(4-chloro-3-ethyl-1-methylpyrazol-5-yl)-N-(2-methylpropoxy)methanamine (PubChem CID 82714391) has the molecular formula C11H20ClN3O and a molecular weight of 245.75 g/mol. Its IUPAC name is 1-(4-chloro-3-ethyl-1-methylpyrazol-5-yl)-N-(2-methylpropoxy)methanamine.
| Compound Name | 1-(4-chloro-3-ethyl-1-methylpyrazol-5-yl)-N-(2-methylpropoxy)methanamine |
|---|---|
| PubChem CID | 82714391 |
| Molecular Formula | C11H20ClN3O |
| Molecular Weight | 245.75 g/mol |
| Exact Mass | 245.13 |
| IUPAC Name | 1-(4-chloro-3-ethyl-1-methylpyrazol-5-yl)-N-(2-methylpropoxy)methanamine |
| SMILES | CCc1nn(C)c(CNOCC(C)C)c1Cl |
| InChI | InChI=1S/C11H20ClN3O/c1-5-9-11(12)10(15(4)14-9)6-13-16-7-8(2)3/h8,13H,5-7H2,1-4H3 |
| InChIKey | JUQHGAAHMRIPNU-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 39.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.75 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|