C9H15N5O4 — CID 106170710
3-[(3-ethyl-1-methyl-4-nitropyrazol-5-yl)amino]-2-hydroxypropanamide (PubChem CID 106170710) has the molecular formula C9H15N5O4 and a molecular weight of 257.25 g/mol. Its IUPAC name is 3-[(3-ethyl-1-methyl-4-nitropyrazol-5-yl)amino]-2-hydroxypropanamide.
| Compound Name | 3-[(3-ethyl-1-methyl-4-nitropyrazol-5-yl)amino]-2-hydroxypropanamide |
|---|---|
| PubChem CID | 106170710 |
| Molecular Formula | C9H15N5O4 |
| Molecular Weight | 257.25 g/mol |
| Exact Mass | 257.11 |
| IUPAC Name | 3-[(3-ethyl-1-methyl-4-nitropyrazol-5-yl)amino]-2-hydroxypropanamide |
| SMILES | CCc1nn(C)c(NCC(O)C(N)=O)c1[N+](=O)[O-] |
| InChI | InChI=1S/C9H15N5O4/c1-3-5-7(14(17)18)9(13(2)12-5)11-4-6(15)8(10)16/h6,11,15H,3-4H2,1-2H3,(H2,10,16) |
| InChIKey | ZRJURFSZYCJXNL-UHFFFAOYSA-N |
| XLogP | -0.85 |
| TPSA | 136.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.25 |
| LogP ≤ 5 | -0.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|