C9H13F3N4O3 — CID 103888520
3-[(3-ethyl-1-methyl-4-nitropyrazol-5-yl)amino]-1,1,1-trifluoropropan-2-ol (PubChem CID 103888520) has the molecular formula C9H13F3N4O3 and a molecular weight of 282.22 g/mol. Its IUPAC name is 3-[(3-ethyl-1-methyl-4-nitropyrazol-5-yl)amino]-1,1,1-trifluoropropan-2-ol.
| Compound Name | 3-[(3-ethyl-1-methyl-4-nitropyrazol-5-yl)amino]-1,1,1-trifluoropropan-2-ol |
|---|---|
| PubChem CID | 103888520 |
| Molecular Formula | C9H13F3N4O3 |
| Molecular Weight | 282.22 g/mol |
| Exact Mass | 282.09 |
| IUPAC Name | 3-[(3-ethyl-1-methyl-4-nitropyrazol-5-yl)amino]-1,1,1-trifluoropropan-2-ol |
| SMILES | CCc1nn(C)c(NCC(O)C(F)(F)F)c1[N+](=O)[O-] |
| InChI | InChI=1S/C9H13F3N4O3/c1-3-5-7(16(18)19)8(15(2)14-5)13-4-6(17)9(10,11)12/h6,13,17H,3-4H2,1-2H3 |
| InChIKey | AAZXVVADLWPQNO-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 93.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.22 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|