C10H19N5O2 — CID 66016810
2-N-(3-ethyl-1-methyl-4-nitropyrazol-5-yl)-2-methylpropane-1,2-diamine (PubChem CID 66016810) has the molecular formula C10H19N5O2 and a molecular weight of 241.29 g/mol. Its IUPAC name is 2-N-(3-ethyl-1-methyl-4-nitropyrazol-5-yl)-2-methylpropane-1,2-diamine.
| Compound Name | 2-N-(3-ethyl-1-methyl-4-nitropyrazol-5-yl)-2-methylpropane-1,2-diamine |
|---|---|
| PubChem CID | 66016810 |
| Molecular Formula | C10H19N5O2 |
| Molecular Weight | 241.29 g/mol |
| Exact Mass | 241.15 |
| IUPAC Name | 2-N-(3-ethyl-1-methyl-4-nitropyrazol-5-yl)-2-methylpropane-1,2-diamine |
| SMILES | CCc1nn(C)c(NC(C)(C)CN)c1[N+](=O)[O-] |
| InChI | InChI=1S/C10H19N5O2/c1-5-7-8(15(16)17)9(14(4)13-7)12-10(2,3)6-11/h12H,5-6,11H2,1-4H3 |
| InChIKey | HZJTUNIWVWDPLH-UHFFFAOYSA-N |
| XLogP | 1.04 |
| TPSA | 99.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.29 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|