C11H19N5O3 — CID 66015582
3-[(3-ethyl-1-methyl-4-nitropyrazol-5-yl)amino]-N,N-dimethylpropanamide (PubChem CID 66015582) has the molecular formula C11H19N5O3 and a molecular weight of 269.30 g/mol. Its IUPAC name is 3-[(3-ethyl-1-methyl-4-nitropyrazol-5-yl)amino]-N,N-dimethylpropanamide.
| Compound Name | 3-[(3-ethyl-1-methyl-4-nitropyrazol-5-yl)amino]-N,N-dimethylpropanamide |
|---|---|
| PubChem CID | 66015582 |
| Molecular Formula | C11H19N5O3 |
| Molecular Weight | 269.30 g/mol |
| Exact Mass | 269.15 |
| IUPAC Name | 3-[(3-ethyl-1-methyl-4-nitropyrazol-5-yl)amino]-N,N-dimethylpropanamide |
| SMILES | CCc1nn(C)c(NCCC(=O)N(C)C)c1[N+](=O)[O-] |
| InChI | InChI=1S/C11H19N5O3/c1-5-8-10(16(18)19)11(15(4)13-8)12-7-6-9(17)14(2)3/h12H,5-7H2,1-4H3 |
| InChIKey | SSJPJYAANXOFJE-UHFFFAOYSA-N |
| XLogP | 0.78 |
| TPSA | 93.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.30 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|