C8H13ClN4O — CID 77103344
2-(4-chloro-3-ethyl-1-methylpyrazol-5-yl)-N'-hydroxyethanimidamide (PubChem CID 77103344) has the molecular formula C8H13ClN4O and a molecular weight of 216.67 g/mol. Its IUPAC name is 2-(4-chloro-3-ethyl-1-methylpyrazol-5-yl)-N'-hydroxyethanimidamide.
| Compound Name | 2-(4-chloro-3-ethyl-1-methylpyrazol-5-yl)-N'-hydroxyethanimidamide |
|---|---|
| PubChem CID | 77103344 |
| Molecular Formula | C8H13ClN4O |
| Molecular Weight | 216.67 g/mol |
| Exact Mass | 216.08 |
| IUPAC Name | 2-(4-chloro-3-ethyl-1-methylpyrazol-5-yl)-N'-hydroxyethanimidamide |
| SMILES | CCc1nn(C)c(CC(N)=NO)c1Cl |
| InChI | InChI=1S/C8H13ClN4O/c1-3-5-8(9)6(13(2)11-5)4-7(10)12-14/h14H,3-4H2,1-2H3,(H2,10,12) |
| InChIKey | PQNZPLCTENPFAE-UHFFFAOYSA-N |
| XLogP | 0.92 |
| TPSA | 76.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.67 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|