About 1-[(4-chloro-3-ethyl-1-methylpyrazol-5-yl)methyl]pyrrolidine-3,4-diol
1-[(4-chloro-3-ethyl-1-methylpyrazol-5-yl)methyl]pyrrolidine-3,4-diol (PubChem CID 106672188) has the molecular formula C11H18ClN3O2
and a molecular weight of 259.74 g/mol. Its IUPAC name is 1-[(4-chloro-3-ethyl-1-methylpyrazol-5-yl)methyl]pyrrolidine-3,4-diol.
Molecular Properties
| Compound Name | 1-[(4-chloro-3-ethyl-1-methylpyrazol-5-yl)methyl]pyrrolidine-3,4-diol |
| PubChem CID | 106672188 |
| Molecular Formula | C11H18ClN3O2 |
| Molecular Weight | 259.74 g/mol |
| Exact Mass | 259.11 |
| IUPAC Name | 1-[(4-chloro-3-ethyl-1-methylpyrazol-5-yl)methyl]pyrrolidine-3,4-diol |
| SMILES | CCc1nn(C)c(CN2CC(O)C(O)C2)c1Cl |
| InChI | InChI=1S/C11H18ClN3O2/c1-3-7-11(12)8(14(2)13-7)4-15-5-9(16)10(17)6-15/h9-10,16-17H,3-6H2,1-2H3 |
| InChIKey | FKHCYKRTSABWLA-UHFFFAOYSA-N |
| XLogP | 0.17 |
| TPSA | 61.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 259.74 |
| LogP ≤ 5 | 0.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 1-[(4-chloro-3-ethyl-1-methylpyrazol-5-yl)methyl]pyrrolidine-3,4-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(4-chloro-3-ethyl-1-methylpyrazol-5-yl)methyl]pyrrolidine-3,4-diol?
The IUPAC name of 1-[(4-chloro-3-ethyl-1-methylpyrazol-5-yl)methyl]pyrrolidine-3,4-diol (CID 106672188) is 1-[(4-chloro-3-ethyl-1-methylpyrazol-5-yl)methyl]pyrrolidine-3,4-diol.
What is the SMILES notation for 1-[(4-chloro-3-ethyl-1-methylpyrazol-5-yl)methyl]pyrrolidine-3,4-diol?
The canonical SMILES for 1-[(4-chloro-3-ethyl-1-methylpyrazol-5-yl)methyl]pyrrolidine-3,4-diol is CCc1nn(C)c(CN2CC(O)C(O)C2)c1Cl.
What is the InChIKey of 1-[(4-chloro-3-ethyl-1-methylpyrazol-5-yl)methyl]pyrrolidine-3,4-diol?
The InChIKey is FKHCYKRTSABWLA-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H18ClN3O2/c1-3-7-11(12)8(14(2)13-7)4-15-5-9(16)10(17)6-15/h9-10,16-17H,3-6H2,1-2H3.
What are the key properties of 1-[(4-chloro-3-ethyl-1-methylpyrazol-5-yl)methyl]pyrrolidine-3,4-diol?
1-[(4-chloro-3-ethyl-1-methylpyrazol-5-yl)methyl]pyrrolidine-3,4-diol has a molecular weight of 259.74 g/mol, XLogP of 0.17, 3 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(4-chloro-3-ethyl-1-methylpyrazol-5-yl)methyl]pyrrolidine-3,4-diol is sourced from PubChem (CID 106672188), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).