C14H24ClN5 — CID 66197341
1-[1-[(4-chloro-3-ethyl-1-methylpyrazol-5-yl)methyl]azetidin-3-yl]piperazine (PubChem CID 66197341) has the molecular formula C14H24ClN5 and a molecular weight of 297.83 g/mol. Its IUPAC name is 1-[1-[(4-chloro-3-ethyl-1-methylpyrazol-5-yl)methyl]azetidin-3-yl]piperazine.
| Compound Name | 1-[1-[(4-chloro-3-ethyl-1-methylpyrazol-5-yl)methyl]azetidin-3-yl]piperazine |
|---|---|
| PubChem CID | 66197341 |
| Molecular Formula | C14H24ClN5 |
| Molecular Weight | 297.83 g/mol |
| Exact Mass | 297.17 |
| IUPAC Name | 1-[1-[(4-chloro-3-ethyl-1-methylpyrazol-5-yl)methyl]azetidin-3-yl]piperazine |
| SMILES | CCc1nn(C)c(CN2CC(N3CCNCC3)C2)c1Cl |
| InChI | InChI=1S/C14H24ClN5/c1-3-12-14(15)13(18(2)17-12)10-19-8-11(9-19)20-6-4-16-5-7-20/h11,16H,3-10H2,1-2H3 |
| InChIKey | YXOBIRRTDIYBMP-UHFFFAOYSA-N |
| XLogP | 0.73 |
| TPSA | 36.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.83 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |