C12H20ClN3O — CID 107225981
(3S)-1-[(4-chloro-3-ethyl-1-methylpyrazol-5-yl)methyl]piperidin-3-ol (PubChem CID 107225981) has the molecular formula C12H20ClN3O and a molecular weight of 257.76 g/mol. Its IUPAC name is (3S)-1-[(4-chloro-3-ethyl-1-methylpyrazol-5-yl)methyl]piperidin-3-ol.
| Compound Name | (3S)-1-[(4-chloro-3-ethyl-1-methylpyrazol-5-yl)methyl]piperidin-3-ol |
|---|---|
| PubChem CID | 107225981 |
| Molecular Formula | C12H20ClN3O |
| Molecular Weight | 257.76 g/mol |
| Exact Mass | 257.13 |
| IUPAC Name | (3S)-1-[(4-chloro-3-ethyl-1-methylpyrazol-5-yl)methyl]piperidin-3-ol |
| SMILES | CCc1nn(C)c(CN2CCC[C@H](O)C2)c1Cl |
| InChI | InChI=1S/C12H20ClN3O/c1-3-10-12(13)11(15(2)14-10)8-16-6-4-5-9(17)7-16/h9,17H,3-8H2,1-2H3/t9-/m0/s1 |
| InChIKey | PHSVCFOXQGJIFU-VIFPVBQESA-N |
| XLogP | 1.59 |
| TPSA | 41.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.76 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |