C12H18ClN3O3 — CID 114351830
1-[(4-chloro-3-ethyl-1-methylpyrazol-5-yl)methyl]-4-hydroxypyrrolidine-2-carboxylic acid (PubChem CID 114351830) has the molecular formula C12H18ClN3O3 and a molecular weight of 287.75 g/mol. Its IUPAC name is 1-[(4-chloro-3-ethyl-1-methylpyrazol-5-yl)methyl]-4-hydroxypyrrolidine-2-carboxylic acid.
| Compound Name | 1-[(4-chloro-3-ethyl-1-methylpyrazol-5-yl)methyl]-4-hydroxypyrrolidine-2-carboxylic acid |
|---|---|
| PubChem CID | 114351830 |
| Molecular Formula | C12H18ClN3O3 |
| Molecular Weight | 287.75 g/mol |
| Exact Mass | 287.10 |
| IUPAC Name | 1-[(4-chloro-3-ethyl-1-methylpyrazol-5-yl)methyl]-4-hydroxypyrrolidine-2-carboxylic acid |
| SMILES | CCc1nn(C)c(CN2CC(O)CC2C(=O)O)c1Cl |
| InChI | InChI=1S/C12H18ClN3O3/c1-3-8-11(13)10(15(2)14-8)6-16-5-7(17)4-9(16)12(18)19/h7,9,17H,3-6H2,1-2H3,(H,18,19) |
| InChIKey | SHWVWIHGXPZMOS-UHFFFAOYSA-N |
| XLogP | 0.66 |
| TPSA | 78.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.75 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |