C9H14ClN3O2 — CID 106702822
(2R)-2-amino-3-(4-chloro-3-ethyl-1-methylpyrazol-5-yl)propanoic acid (PubChem CID 106702822) has the molecular formula C9H14ClN3O2 and a molecular weight of 231.68 g/mol. Its IUPAC name is (2R)-2-amino-3-(4-chloro-3-ethyl-1-methylpyrazol-5-yl)propanoic acid.
| Compound Name | (2R)-2-amino-3-(4-chloro-3-ethyl-1-methylpyrazol-5-yl)propanoic acid |
|---|---|
| PubChem CID | 106702822 |
| Molecular Formula | C9H14ClN3O2 |
| Molecular Weight | 231.68 g/mol |
| Exact Mass | 231.08 |
| IUPAC Name | (2R)-2-amino-3-(4-chloro-3-ethyl-1-methylpyrazol-5-yl)propanoic acid |
| SMILES | CCc1nn(C)c(C[C@@H](N)C(=O)O)c1Cl |
| InChI | InChI=1S/C9H14ClN3O2/c1-3-6-8(10)7(13(2)12-6)4-5(11)9(14)15/h5H,3-4,11H2,1-2H3,(H,14,15)/t5-/m1/s1 |
| InChIKey | LWYVSPSNNJMRGB-RXMQYKEDSA-N |
| XLogP | 0.59 |
| TPSA | 81.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.68 |
| LogP ≤ 5 | 0.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |