C11H17ClN2O3S — CID 105355535
2-[(4-chloro-3-ethyl-1-methylpyrazol-5-yl)methylsulfinyl]butanoic acid (PubChem CID 105355535) has the molecular formula C11H17ClN2O3S and a molecular weight of 292.79 g/mol. Its IUPAC name is 2-[(4-chloro-3-ethyl-1-methylpyrazol-5-yl)methylsulfinyl]butanoic acid.
| Compound Name | 2-[(4-chloro-3-ethyl-1-methylpyrazol-5-yl)methylsulfinyl]butanoic acid |
|---|---|
| PubChem CID | 105355535 |
| Molecular Formula | C11H17ClN2O3S |
| Molecular Weight | 292.79 g/mol |
| Exact Mass | 292.06 |
| IUPAC Name | 2-[(4-chloro-3-ethyl-1-methylpyrazol-5-yl)methylsulfinyl]butanoic acid |
| SMILES | CCc1nn(C)c(CS(=O)C(CC)C(=O)O)c1Cl |
| InChI | InChI=1S/C11H17ClN2O3S/c1-4-7-10(12)8(14(3)13-7)6-18(17)9(5-2)11(15)16/h9H,4-6H2,1-3H3,(H,15,16) |
| InChIKey | WAVPXUNENHHWFD-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.79 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |