C11H17ClN2O2S — CID 81227720
2-[(4-chloro-3-ethyl-1-methylpyrazol-5-yl)methylsulfanyl]-2-methylpropanoic acid (PubChem CID 81227720) has the molecular formula C11H17ClN2O2S and a molecular weight of 276.79 g/mol. Its IUPAC name is 2-[(4-chloro-3-ethyl-1-methylpyrazol-5-yl)methylsulfanyl]-2-methylpropanoic acid.
| Compound Name | 2-[(4-chloro-3-ethyl-1-methylpyrazol-5-yl)methylsulfanyl]-2-methylpropanoic acid |
|---|---|
| PubChem CID | 81227720 |
| Molecular Formula | C11H17ClN2O2S |
| Molecular Weight | 276.79 g/mol |
| Exact Mass | 276.07 |
| IUPAC Name | 2-[(4-chloro-3-ethyl-1-methylpyrazol-5-yl)methylsulfanyl]-2-methylpropanoic acid |
| SMILES | CCc1nn(C)c(CSC(C)(C)C(=O)O)c1Cl |
| InChI | InChI=1S/C11H17ClN2O2S/c1-5-7-9(12)8(14(4)13-7)6-17-11(2,3)10(15)16/h5-6H2,1-4H3,(H,15,16) |
| InChIKey | CTHLVBPKTXPLQU-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.79 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |