C11H20ClN3OS — CID 81189159
1-[(4-chloro-3-ethyl-1-methylpyrazol-5-yl)methylsulfinyl]butan-2-amine (PubChem CID 81189159) has the molecular formula C11H20ClN3OS and a molecular weight of 277.82 g/mol. Its IUPAC name is 1-[(4-chloro-3-ethyl-1-methylpyrazol-5-yl)methylsulfinyl]butan-2-amine.
| Compound Name | 1-[(4-chloro-3-ethyl-1-methylpyrazol-5-yl)methylsulfinyl]butan-2-amine |
|---|---|
| PubChem CID | 81189159 |
| Molecular Formula | C11H20ClN3OS |
| Molecular Weight | 277.82 g/mol |
| Exact Mass | 277.10 |
| IUPAC Name | 1-[(4-chloro-3-ethyl-1-methylpyrazol-5-yl)methylsulfinyl]butan-2-amine |
| SMILES | CCc1nn(C)c(CS(=O)CC(N)CC)c1Cl |
| InChI | InChI=1S/C11H20ClN3OS/c1-4-8(13)6-17(16)7-10-11(12)9(5-2)14-15(10)3/h8H,4-7,13H2,1-3H3 |
| InChIKey | NFYFNNJRGFJOTJ-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 60.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.82 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |