C15H25ClN4 — CID 66243788
5-[(4-chloro-3-ethyl-1-methylpyrazol-5-yl)methyl]-4,4-dimethyl-1,2,3,3a,6,6a-hexahydropyrrolo[3,4-c]pyrrole (PubChem CID 66243788) has the molecular formula C15H25ClN4 and a molecular weight of 296.85 g/mol. Its IUPAC name is 5-[(4-chloro-3-ethyl-1-methylpyrazol-5-yl)methyl]-4,4-dimethyl-1,2,3,3a,6,6a-hexahydropyrrolo[3,4-c]pyrrole.
| Compound Name | 5-[(4-chloro-3-ethyl-1-methylpyrazol-5-yl)methyl]-4,4-dimethyl-1,2,3,3a,6,6a-hexahydropyrrolo[3,4-c]pyrrole |
|---|---|
| PubChem CID | 66243788 |
| Molecular Formula | C15H25ClN4 |
| Molecular Weight | 296.85 g/mol |
| Exact Mass | 296.18 |
| IUPAC Name | 5-[(4-chloro-3-ethyl-1-methylpyrazol-5-yl)methyl]-4,4-dimethyl-1,2,3,3a,6,6a-hexahydropyrrolo[3,4-c]pyrrole |
| SMILES | CCc1nn(C)c(CN2CC3CNCC3C2(C)C)c1Cl |
| InChI | InChI=1S/C15H25ClN4/c1-5-12-14(16)13(19(4)18-12)9-20-8-10-6-17-7-11(10)15(20,2)3/h10-11,17H,5-9H2,1-4H3 |
| InChIKey | QNKDXFKTCMDOEV-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 33.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.85 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |