C13H24N6 — CID 66243182
4,4-dimethyl-5-[(1-propyltetrazol-5-yl)methyl]-1,2,3,3a,6,6a-hexahydropyrrolo[3,4-c]pyrrole (PubChem CID 66243182) has the molecular formula C13H24N6 and a molecular weight of 264.38 g/mol. Its IUPAC name is 4,4-dimethyl-5-[(1-propyltetrazol-5-yl)methyl]-1,2,3,3a,6,6a-hexahydropyrrolo[3,4-c]pyrrole.
| Compound Name | 4,4-dimethyl-5-[(1-propyltetrazol-5-yl)methyl]-1,2,3,3a,6,6a-hexahydropyrrolo[3,4-c]pyrrole |
|---|---|
| PubChem CID | 66243182 |
| Molecular Formula | C13H24N6 |
| Molecular Weight | 264.38 g/mol |
| Exact Mass | 264.21 |
| IUPAC Name | 4,4-dimethyl-5-[(1-propyltetrazol-5-yl)methyl]-1,2,3,3a,6,6a-hexahydropyrrolo[3,4-c]pyrrole |
| SMILES | CCCn1nnnc1CN1CC2CNCC2C1(C)C |
| InChI | InChI=1S/C13H24N6/c1-4-5-19-12(15-16-17-19)9-18-8-10-6-14-7-11(10)13(18,2)3/h10-11,14H,4-9H2,1-3H3 |
| InChIKey | FKCWCTJGMDAROA-UHFFFAOYSA-N |
| XLogP | 0.51 |
| TPSA | 58.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.38 |
| LogP ≤ 5 | 0.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |