C10H15Cl2N3O2 — CID 103491649
methyl 2-chloro-3-[(4-chloro-1,3-dimethylpyrazol-5-yl)methylamino]propanoate (PubChem CID 103491649) has the molecular formula C10H15Cl2N3O2 and a molecular weight of 280.15 g/mol. Its IUPAC name is methyl 2-chloro-3-[(4-chloro-1,3-dimethylpyrazol-5-yl)methylamino]propanoate.
| Compound Name | methyl 2-chloro-3-[(4-chloro-1,3-dimethylpyrazol-5-yl)methylamino]propanoate |
|---|---|
| PubChem CID | 103491649 |
| Molecular Formula | C10H15Cl2N3O2 |
| Molecular Weight | 280.15 g/mol |
| Exact Mass | 279.05 |
| IUPAC Name | methyl 2-chloro-3-[(4-chloro-1,3-dimethylpyrazol-5-yl)methylamino]propanoate |
| SMILES | COC(=O)C(Cl)CNCc1c(Cl)c(C)nn1C |
| InChI | InChI=1S/C10H15Cl2N3O2/c1-6-9(12)8(15(2)14-6)5-13-4-7(11)10(16)17-3/h7,13H,4-5H2,1-3H3 |
| InChIKey | CGOYSYHNXWGOJP-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 56.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.15 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|