C13H19ClN2O — CID 103455647
1-(4-chloro-1,3-diethylpyrazol-5-yl)-4-methylpent-3-en-2-one (PubChem CID 103455647) has the molecular formula C13H19ClN2O and a molecular weight of 254.76 g/mol. Its IUPAC name is 1-(4-chloro-1,3-diethylpyrazol-5-yl)-4-methylpent-3-en-2-one.
| Compound Name | 1-(4-chloro-1,3-diethylpyrazol-5-yl)-4-methylpent-3-en-2-one |
|---|---|
| PubChem CID | 103455647 |
| Molecular Formula | C13H19ClN2O |
| Molecular Weight | 254.76 g/mol |
| Exact Mass | 254.12 |
| IUPAC Name | 1-(4-chloro-1,3-diethylpyrazol-5-yl)-4-methylpent-3-en-2-one |
| SMILES | CCc1nn(CC)c(CC(=O)C=C(C)C)c1Cl |
| InChI | InChI=1S/C13H19ClN2O/c1-5-11-13(14)12(16(6-2)15-11)8-10(17)7-9(3)4/h7H,5-6,8H2,1-4H3 |
| InChIKey | HLFNLEYYZKUXRY-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 34.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.76 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|