C16H27ClN2O — CID 115778515
1-(4-chloro-1,3-diethylpyrazol-5-yl)-3-ethylheptan-2-one (PubChem CID 115778515) has the molecular formula C16H27ClN2O and a molecular weight of 298.86 g/mol. Its IUPAC name is 1-(4-chloro-1,3-diethylpyrazol-5-yl)-3-ethylheptan-2-one.
| Compound Name | 1-(4-chloro-1,3-diethylpyrazol-5-yl)-3-ethylheptan-2-one |
|---|---|
| PubChem CID | 115778515 |
| Molecular Formula | C16H27ClN2O |
| Molecular Weight | 298.86 g/mol |
| Exact Mass | 298.18 |
| IUPAC Name | 1-(4-chloro-1,3-diethylpyrazol-5-yl)-3-ethylheptan-2-one |
| SMILES | CCCCC(CC)C(=O)Cc1c(Cl)c(CC)nn1CC |
| InChI | InChI=1S/C16H27ClN2O/c1-5-9-10-12(6-2)15(20)11-14-16(17)13(7-3)18-19(14)8-4/h12H,5-11H2,1-4H3 |
| InChIKey | FSUZKEPYTNDZFZ-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 34.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.86 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |