C15H26ClN3O — CID 116551505
8-amino-1-(4-chloro-1,3-diethylpyrazol-5-yl)octan-2-one (PubChem CID 116551505) has the molecular formula C15H26ClN3O and a molecular weight of 299.85 g/mol. Its IUPAC name is 8-amino-1-(4-chloro-1,3-diethylpyrazol-5-yl)octan-2-one.
| Compound Name | 8-amino-1-(4-chloro-1,3-diethylpyrazol-5-yl)octan-2-one |
|---|---|
| PubChem CID | 116551505 |
| Molecular Formula | C15H26ClN3O |
| Molecular Weight | 299.85 g/mol |
| Exact Mass | 299.18 |
| IUPAC Name | 8-amino-1-(4-chloro-1,3-diethylpyrazol-5-yl)octan-2-one |
| SMILES | CCc1nn(CC)c(CC(=O)CCCCCCN)c1Cl |
| InChI | InChI=1S/C15H26ClN3O/c1-3-13-15(16)14(19(4-2)18-13)11-12(20)9-7-5-6-8-10-17/h3-11,17H2,1-2H3 |
| InChIKey | YSBWHODRLGRSLY-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 60.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.85 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|