C15H23ClN2O — CID 103458953
1-(4-chloro-1,3-diethylpyrazol-5-yl)-4-ethylhex-3-en-2-one (PubChem CID 103458953) has the molecular formula C15H23ClN2O and a molecular weight of 282.81 g/mol. Its IUPAC name is 1-(4-chloro-1,3-diethylpyrazol-5-yl)-4-ethylhex-3-en-2-one.
| Compound Name | 1-(4-chloro-1,3-diethylpyrazol-5-yl)-4-ethylhex-3-en-2-one |
|---|---|
| PubChem CID | 103458953 |
| Molecular Formula | C15H23ClN2O |
| Molecular Weight | 282.81 g/mol |
| Exact Mass | 282.15 |
| IUPAC Name | 1-(4-chloro-1,3-diethylpyrazol-5-yl)-4-ethylhex-3-en-2-one |
| SMILES | CCC(=CC(=O)Cc1c(Cl)c(CC)nn1CC)CC |
| InChI | InChI=1S/C15H23ClN2O/c1-5-11(6-2)9-12(19)10-14-15(16)13(7-3)17-18(14)8-4/h9H,5-8,10H2,1-4H3 |
| InChIKey | HVMROFSFDHJYFM-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 34.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.81 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|