C14H22ClN5 — CID 106104808
N-[(4-chloro-1,3-diethylpyrazol-5-yl)methyl]-2-(1-methylpyrazol-3-yl)ethanamine (PubChem CID 106104808) has the molecular formula C14H22ClN5 and a molecular weight of 295.82 g/mol. Its IUPAC name is N-[(4-chloro-1,3-diethylpyrazol-5-yl)methyl]-2-(1-methylpyrazol-3-yl)ethanamine.
| Compound Name | N-[(4-chloro-1,3-diethylpyrazol-5-yl)methyl]-2-(1-methylpyrazol-3-yl)ethanamine |
|---|---|
| PubChem CID | 106104808 |
| Molecular Formula | C14H22ClN5 |
| Molecular Weight | 295.82 g/mol |
| Exact Mass | 295.16 |
| IUPAC Name | N-[(4-chloro-1,3-diethylpyrazol-5-yl)methyl]-2-(1-methylpyrazol-3-yl)ethanamine |
| SMILES | CCc1nn(CC)c(CNCCc2ccn(C)n2)c1Cl |
| InChI | InChI=1S/C14H22ClN5/c1-4-12-14(15)13(20(5-2)18-12)10-16-8-6-11-7-9-19(3)17-11/h7,9,16H,4-6,8,10H2,1-3H3 |
| InChIKey | WQRWWEKFEVBVSE-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 47.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.82 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|