C13H19ClN4S — CID 106046503
2-(5-chlorothiophen-2-yl)-N-[[2-(2-methylpropyl)-1,2,4-triazol-3-yl]methyl]ethanamine (PubChem CID 106046503) has the molecular formula C13H19ClN4S and a molecular weight of 298.84 g/mol. Its IUPAC name is 2-(5-chlorothiophen-2-yl)-N-[[2-(2-methylpropyl)-1,2,4-triazol-3-yl]methyl]ethanamine.
| Compound Name | 2-(5-chlorothiophen-2-yl)-N-[[2-(2-methylpropyl)-1,2,4-triazol-3-yl]methyl]ethanamine |
|---|---|
| PubChem CID | 106046503 |
| Molecular Formula | C13H19ClN4S |
| Molecular Weight | 298.84 g/mol |
| Exact Mass | 298.10 |
| IUPAC Name | 2-(5-chlorothiophen-2-yl)-N-[[2-(2-methylpropyl)-1,2,4-triazol-3-yl]methyl]ethanamine |
| SMILES | CC(C)Cn1ncnc1CNCCc1ccc(Cl)s1 |
| InChI | InChI=1S/C13H19ClN4S/c1-10(2)8-18-13(16-9-17-18)7-15-6-5-11-3-4-12(14)19-11/h3-4,9-10,15H,5-8H2,1-2H3 |
| InChIKey | JKYZSUZZHKCQKX-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 42.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.84 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|