C12H17BrN4S — CID 106046837
2-(5-bromothiophen-2-yl)-N-[(2-propan-2-yl-1,2,4-triazol-3-yl)methyl]ethanamine (PubChem CID 106046837) has the molecular formula C12H17BrN4S and a molecular weight of 329.27 g/mol. Its IUPAC name is 2-(5-bromothiophen-2-yl)-N-[(2-propan-2-yl-1,2,4-triazol-3-yl)methyl]ethanamine.
| Compound Name | 2-(5-bromothiophen-2-yl)-N-[(2-propan-2-yl-1,2,4-triazol-3-yl)methyl]ethanamine |
|---|---|
| PubChem CID | 106046837 |
| Molecular Formula | C12H17BrN4S |
| Molecular Weight | 329.27 g/mol |
| Exact Mass | 328.04 |
| IUPAC Name | 2-(5-bromothiophen-2-yl)-N-[(2-propan-2-yl-1,2,4-triazol-3-yl)methyl]ethanamine |
| SMILES | CC(C)n1ncnc1CNCCc1ccc(Br)s1 |
| InChI | InChI=1S/C12H17BrN4S/c1-9(2)17-12(15-8-16-17)7-14-6-5-10-3-4-11(13)18-10/h3-4,8-9,14H,5-7H2,1-2H3 |
| InChIKey | OFCIRWFXONOSCW-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 42.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.27 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|