C13H25ClN4 — CID 107155976
2-chloro-4-methyl-N-[[2-(2-methylpropyl)-1,2,4-triazol-3-yl]methyl]pentan-1-amine (PubChem CID 107155976) has the molecular formula C13H25ClN4 and a molecular weight of 272.82 g/mol. Its IUPAC name is 2-chloro-4-methyl-N-[[2-(2-methylpropyl)-1,2,4-triazol-3-yl]methyl]pentan-1-amine.
| Compound Name | 2-chloro-4-methyl-N-[[2-(2-methylpropyl)-1,2,4-triazol-3-yl]methyl]pentan-1-amine |
|---|---|
| PubChem CID | 107155976 |
| Molecular Formula | C13H25ClN4 |
| Molecular Weight | 272.82 g/mol |
| Exact Mass | 272.18 |
| IUPAC Name | 2-chloro-4-methyl-N-[[2-(2-methylpropyl)-1,2,4-triazol-3-yl]methyl]pentan-1-amine |
| SMILES | CC(C)CC(Cl)CNCc1ncnn1CC(C)C |
| InChI | InChI=1S/C13H25ClN4/c1-10(2)5-12(14)6-15-7-13-16-9-17-18(13)8-11(3)4/h9-12,15H,5-8H2,1-4H3 |
| InChIKey | IXAXGERDMGGWPN-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 42.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.82 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|