C11H13ClN2S2 — CID 115633678
2-(5-chlorothiophen-2-yl)-N-[(4-methyl-1,3-thiazol-2-yl)methyl]ethanamine (PubChem CID 115633678) has the molecular formula C11H13ClN2S2 and a molecular weight of 272.83 g/mol. Its IUPAC name is 2-(5-chlorothiophen-2-yl)-N-[(4-methyl-1,3-thiazol-2-yl)methyl]ethanamine.
| Compound Name | 2-(5-chlorothiophen-2-yl)-N-[(4-methyl-1,3-thiazol-2-yl)methyl]ethanamine |
|---|---|
| PubChem CID | 115633678 |
| Molecular Formula | C11H13ClN2S2 |
| Molecular Weight | 272.83 g/mol |
| Exact Mass | 272.02 |
| IUPAC Name | 2-(5-chlorothiophen-2-yl)-N-[(4-methyl-1,3-thiazol-2-yl)methyl]ethanamine |
| SMILES | Cc1csc(CNCCc2ccc(Cl)s2)n1 |
| InChI | InChI=1S/C11H13ClN2S2/c1-8-7-15-11(14-8)6-13-5-4-9-2-3-10(12)16-9/h2-3,7,13H,4-6H2,1H3 |
| InChIKey | TVEMSCUEPSREBE-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.83 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|