C12H22F3N5O — CID 103151667
[1-[2-(2-methylpropyl)-1,2,4-triazol-3-yl]-4-(2,2,2-trifluoroethoxy)butan-2-yl]hydrazine (PubChem CID 103151667) has the molecular formula C12H22F3N5O and a molecular weight of 309.34 g/mol. Its IUPAC name is [1-[2-(2-methylpropyl)-1,2,4-triazol-3-yl]-4-(2,2,2-trifluoroethoxy)butan-2-yl]hydrazine.
| Compound Name | [1-[2-(2-methylpropyl)-1,2,4-triazol-3-yl]-4-(2,2,2-trifluoroethoxy)butan-2-yl]hydrazine |
|---|---|
| PubChem CID | 103151667 |
| Molecular Formula | C12H22F3N5O |
| Molecular Weight | 309.34 g/mol |
| Exact Mass | 309.18 |
| IUPAC Name | [1-[2-(2-methylpropyl)-1,2,4-triazol-3-yl]-4-(2,2,2-trifluoroethoxy)butan-2-yl]hydrazine |
| SMILES | CC(C)Cn1ncnc1CC(CCOCC(F)(F)F)NN |
| InChI | InChI=1S/C12H22F3N5O/c1-9(2)6-20-11(17-8-18-20)5-10(19-16)3-4-21-7-12(13,14)15/h8-10,19H,3-7,16H2,1-2H3 |
| InChIKey | XWTZVPYAAQHTFQ-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 77.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.34 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|