C12H25N5O2 — CID 102929979
[4-(2-methoxyethoxy)-1-(2-propyl-1,2,4-triazol-3-yl)butan-2-yl]hydrazine (PubChem CID 102929979) has the molecular formula C12H25N5O2 and a molecular weight of 271.36 g/mol. Its IUPAC name is [4-(2-methoxyethoxy)-1-(2-propyl-1,2,4-triazol-3-yl)butan-2-yl]hydrazine.
| Compound Name | [4-(2-methoxyethoxy)-1-(2-propyl-1,2,4-triazol-3-yl)butan-2-yl]hydrazine |
|---|---|
| PubChem CID | 102929979 |
| Molecular Formula | C12H25N5O2 |
| Molecular Weight | 271.36 g/mol |
| Exact Mass | 271.20 |
| IUPAC Name | [4-(2-methoxyethoxy)-1-(2-propyl-1,2,4-triazol-3-yl)butan-2-yl]hydrazine |
| SMILES | CCCn1ncnc1CC(CCOCCOC)NN |
| InChI | InChI=1S/C12H25N5O2/c1-3-5-17-12(14-10-15-17)9-11(16-13)4-6-19-8-7-18-2/h10-11,16H,3-9,13H2,1-2H3 |
| InChIKey | ZFSDBPICBJZKHD-UHFFFAOYSA-N |
| XLogP | 0.12 |
| TPSA | 87.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.36 |
| LogP ≤ 5 | 0.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|