C14H26F2N4O — CID 103149944
4-(2,2-difluoroethoxy)-N-propyl-1-(2-propyl-1,2,4-triazol-3-yl)butan-2-amine (PubChem CID 103149944) has the molecular formula C14H26F2N4O and a molecular weight of 304.38 g/mol. Its IUPAC name is 4-(2,2-difluoroethoxy)-N-propyl-1-(2-propyl-1,2,4-triazol-3-yl)butan-2-amine.
| Compound Name | 4-(2,2-difluoroethoxy)-N-propyl-1-(2-propyl-1,2,4-triazol-3-yl)butan-2-amine |
|---|---|
| PubChem CID | 103149944 |
| Molecular Formula | C14H26F2N4O |
| Molecular Weight | 304.38 g/mol |
| Exact Mass | 304.21 |
| IUPAC Name | 4-(2,2-difluoroethoxy)-N-propyl-1-(2-propyl-1,2,4-triazol-3-yl)butan-2-amine |
| SMILES | CCCNC(CCOCC(F)F)Cc1ncnn1CCC |
| InChI | InChI=1S/C14H26F2N4O/c1-3-6-17-12(5-8-21-10-13(15)16)9-14-18-11-19-20(14)7-4-2/h11-13,17H,3-10H2,1-2H3 |
| InChIKey | BXCDQWNTRXJZDH-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 51.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.38 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|