C12H19N5S — CID 105211942
[1-(2-propyl-1,2,4-triazol-3-yl)-3-thiophen-2-ylpropan-2-yl]hydrazine (PubChem CID 105211942) has the molecular formula C12H19N5S and a molecular weight of 265.39 g/mol. Its IUPAC name is [1-(2-propyl-1,2,4-triazol-3-yl)-3-thiophen-2-ylpropan-2-yl]hydrazine.
| Compound Name | [1-(2-propyl-1,2,4-triazol-3-yl)-3-thiophen-2-ylpropan-2-yl]hydrazine |
|---|---|
| PubChem CID | 105211942 |
| Molecular Formula | C12H19N5S |
| Molecular Weight | 265.39 g/mol |
| Exact Mass | 265.14 |
| IUPAC Name | [1-(2-propyl-1,2,4-triazol-3-yl)-3-thiophen-2-ylpropan-2-yl]hydrazine |
| SMILES | CCCn1ncnc1CC(Cc1cccs1)NN |
| InChI | InChI=1S/C12H19N5S/c1-2-5-17-12(14-9-15-17)8-10(16-13)7-11-4-3-6-18-11/h3-4,6,9-10,16H,2,5,7-8,13H2,1H3 |
| InChIKey | FLGUVIAYZAAZFR-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 68.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.39 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|