C10H21N5 — CID 105201026
1-[2-(2-methylpropyl)-1,2,4-triazol-3-yl]butan-2-ylhydrazine (PubChem CID 105201026) has the molecular formula C10H21N5 and a molecular weight of 211.31 g/mol. Its IUPAC name is 1-[2-(2-methylpropyl)-1,2,4-triazol-3-yl]butan-2-ylhydrazine.
| Compound Name | 1-[2-(2-methylpropyl)-1,2,4-triazol-3-yl]butan-2-ylhydrazine |
|---|---|
| PubChem CID | 105201026 |
| Molecular Formula | C10H21N5 |
| Molecular Weight | 211.31 g/mol |
| Exact Mass | 211.18 |
| IUPAC Name | 1-[2-(2-methylpropyl)-1,2,4-triazol-3-yl]butan-2-ylhydrazine |
| SMILES | CCC(Cc1ncnn1CC(C)C)NN |
| InChI | InChI=1S/C10H21N5/c1-4-9(14-11)5-10-12-7-13-15(10)6-8(2)3/h7-9,14H,4-6,11H2,1-3H3 |
| InChIKey | GXQXIINZLMQVIQ-UHFFFAOYSA-N |
| XLogP | 0.72 |
| TPSA | 68.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.31 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|