C15H24N6 — CID 107504998
[1-(2,6-dimethyl-4-pyridinyl)-2-[2-(2-methylpropyl)-1,2,4-triazol-3-yl]ethyl]hydrazine (PubChem CID 107504998) has the molecular formula C15H24N6 and a molecular weight of 288.40 g/mol. Its IUPAC name is [1-(2,6-dimethyl-4-pyridinyl)-2-[2-(2-methylpropyl)-1,2,4-triazol-3-yl]ethyl]hydrazine.
| Compound Name | [1-(2,6-dimethyl-4-pyridinyl)-2-[2-(2-methylpropyl)-1,2,4-triazol-3-yl]ethyl]hydrazine |
|---|---|
| PubChem CID | 107504998 |
| Molecular Formula | C15H24N6 |
| Molecular Weight | 288.40 g/mol |
| Exact Mass | 288.21 |
| IUPAC Name | [1-(2,6-dimethyl-4-pyridinyl)-2-[2-(2-methylpropyl)-1,2,4-triazol-3-yl]ethyl]hydrazine |
| SMILES | Cc1cc(C(Cc2ncnn2CC(C)C)NN)cc(C)n1 |
| InChI | InChI=1S/C15H24N6/c1-10(2)8-21-15(17-9-18-21)7-14(20-16)13-5-11(3)19-12(4)6-13/h5-6,9-10,14,20H,7-8,16H2,1-4H3 |
| InChIKey | UUTIWDWWMPSETH-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 81.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.40 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|