C14H19BrClN5 — CID 107948328
[1-(3-bromo-5-chlorophenyl)-2-[2-(2-methylpropyl)-1,2,4-triazol-3-yl]ethyl]hydrazine (PubChem CID 107948328) has the molecular formula C14H19BrClN5 and a molecular weight of 372.70 g/mol. Its IUPAC name is [1-(3-bromo-5-chlorophenyl)-2-[2-(2-methylpropyl)-1,2,4-triazol-3-yl]ethyl]hydrazine.
| Compound Name | [1-(3-bromo-5-chlorophenyl)-2-[2-(2-methylpropyl)-1,2,4-triazol-3-yl]ethyl]hydrazine |
|---|---|
| PubChem CID | 107948328 |
| Molecular Formula | C14H19BrClN5 |
| Molecular Weight | 372.70 g/mol |
| Exact Mass | 371.05 |
| IUPAC Name | [1-(3-bromo-5-chlorophenyl)-2-[2-(2-methylpropyl)-1,2,4-triazol-3-yl]ethyl]hydrazine |
| SMILES | CC(C)Cn1ncnc1CC(NN)c1cc(Cl)cc(Br)c1 |
| InChI | InChI=1S/C14H19BrClN5/c1-9(2)7-21-14(18-8-19-21)6-13(20-17)10-3-11(15)5-12(16)4-10/h3-5,8-9,13,20H,6-7,17H2,1-2H3 |
| InChIKey | DYQFRRQGCQMSLI-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 68.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.70 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|