C12H18N6 — CID 106756611
[2-(2-ethyl-1,2,4-triazol-3-yl)-1-(2-methyl-4-pyridinyl)ethyl]hydrazine (PubChem CID 106756611) has the molecular formula C12H18N6 and a molecular weight of 246.32 g/mol. Its IUPAC name is [2-(2-ethyl-1,2,4-triazol-3-yl)-1-(2-methyl-4-pyridinyl)ethyl]hydrazine.
| Compound Name | [2-(2-ethyl-1,2,4-triazol-3-yl)-1-(2-methyl-4-pyridinyl)ethyl]hydrazine |
|---|---|
| PubChem CID | 106756611 |
| Molecular Formula | C12H18N6 |
| Molecular Weight | 246.32 g/mol |
| Exact Mass | 246.16 |
| IUPAC Name | [2-(2-ethyl-1,2,4-triazol-3-yl)-1-(2-methyl-4-pyridinyl)ethyl]hydrazine |
| SMILES | CCn1ncnc1CC(NN)c1ccnc(C)c1 |
| InChI | InChI=1S/C12H18N6/c1-3-18-12(15-8-16-18)7-11(17-13)10-4-5-14-9(2)6-10/h4-6,8,11,17H,3,7,13H2,1-2H3 |
| InChIKey | WFRDFEIXPLMHKH-UHFFFAOYSA-N |
| XLogP | 0.75 |
| TPSA | 81.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.32 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|