C11H17N5O — CID 105318542
[2-(2-ethyl-1,2,4-triazol-3-yl)-1-(5-methylfuran-3-yl)ethyl]hydrazine (PubChem CID 105318542) has the molecular formula C11H17N5O and a molecular weight of 235.29 g/mol. Its IUPAC name is [2-(2-ethyl-1,2,4-triazol-3-yl)-1-(5-methylfuran-3-yl)ethyl]hydrazine.
| Compound Name | [2-(2-ethyl-1,2,4-triazol-3-yl)-1-(5-methylfuran-3-yl)ethyl]hydrazine |
|---|---|
| PubChem CID | 105318542 |
| Molecular Formula | C11H17N5O |
| Molecular Weight | 235.29 g/mol |
| Exact Mass | 235.14 |
| IUPAC Name | [2-(2-ethyl-1,2,4-triazol-3-yl)-1-(5-methylfuran-3-yl)ethyl]hydrazine |
| SMILES | CCn1ncnc1CC(NN)c1coc(C)c1 |
| InChI | InChI=1S/C11H17N5O/c1-3-16-11(13-7-14-16)5-10(15-12)9-4-8(2)17-6-9/h4,6-7,10,15H,3,5,12H2,1-2H3 |
| InChIKey | NNLBZVLUBXQQPG-UHFFFAOYSA-N |
| XLogP | 0.95 |
| TPSA | 81.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.29 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|