C12H15ClIN5 — CID 114030598
[1-(5-chloro-2-iodophenyl)-2-(2-ethyl-1,2,4-triazol-3-yl)ethyl]hydrazine (PubChem CID 114030598) has the molecular formula C12H15ClIN5 and a molecular weight of 391.64 g/mol. Its IUPAC name is [1-(5-chloro-2-iodophenyl)-2-(2-ethyl-1,2,4-triazol-3-yl)ethyl]hydrazine.
| Compound Name | [1-(5-chloro-2-iodophenyl)-2-(2-ethyl-1,2,4-triazol-3-yl)ethyl]hydrazine |
|---|---|
| PubChem CID | 114030598 |
| Molecular Formula | C12H15ClIN5 |
| Molecular Weight | 391.64 g/mol |
| Exact Mass | 391.01 |
| IUPAC Name | [1-(5-chloro-2-iodophenyl)-2-(2-ethyl-1,2,4-triazol-3-yl)ethyl]hydrazine |
| SMILES | CCn1ncnc1CC(NN)c1cc(Cl)ccc1I |
| InChI | InChI=1S/C12H15ClIN5/c1-2-19-12(16-7-17-19)6-11(18-15)9-5-8(13)3-4-10(9)14/h3-5,7,11,18H,2,6,15H2,1H3 |
| InChIKey | HMMQVOYGFWZAAB-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 68.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.64 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|